C17H35Cl2N3O2 — CID 120798325
(2S,5R)-5-(aminomethyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]oxolane-2-carboxamide;dihydrochloride (PubChem CID 120798325) has the molecular formula C17H35Cl2N3O2 and a molecular weight of 384.39 g/mol. Its IUPAC name is (2S,5R)-5-(aminomethyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]oxolane-2-carboxamide;dihydrochloride.
| Compound Name | (2S,5R)-5-(aminomethyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]oxolane-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 120798325 |
| Molecular Formula | C17H35Cl2N3O2 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | (2S,5R)-5-(aminomethyl)-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]oxolane-2-carboxamide;dihydrochloride |
| SMILES | CC1CC(C)CN(CCCCNC(=O)[C@@H]2CC[C@H](CN)O2)C1.Cl.Cl |
| InChI | InChI=1S/C17H33N3O2.2ClH/c1-13-9-14(2)12-20(11-13)8-4-3-7-19-17(21)16-6-5-15(10-18)22-16;;/h13-16H,3-12,18H2,1-2H3,(H,19,21);2*1H/t13?,14?,15-,16+;;/m1../s1 |
| InChIKey | UNAWNYBCGKEKBM-BYKPPLSGSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|