C9H19ClN2O2S — CID 119706942
N-(3-methylsulfanylpropyl)morpholine-2-carboxamide;hydrochloride (PubChem CID 119706942) has the molecular formula C9H19ClN2O2S and a molecular weight of 254.78 g/mol. Its IUPAC name is N-(3-methylsulfanylpropyl)morpholine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-methylsulfanylpropyl)morpholine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119706942 |
| Molecular Formula | C9H19ClN2O2S |
| Molecular Weight | 254.78 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | N-(3-methylsulfanylpropyl)morpholine-2-carboxamide;hydrochloride |
| SMILES | CSCCCNC(=O)C1CNCCO1.Cl |
| InChI | InChI=1S/C9H18N2O2S.ClH/c1-14-6-2-3-11-9(12)8-7-10-4-5-13-8;/h8,10H,2-7H2,1H3,(H,11,12);1H |
| InChIKey | JIKDXIAQFHHHSX-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.78 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|