C16H35Cl2N3O2 — CID 119840980
7-amino-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]heptanamide;dihydrochloride (PubChem CID 119840980) has the molecular formula C16H35Cl2N3O2 and a molecular weight of 372.38 g/mol. Its IUPAC name is 7-amino-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119840980 |
| Molecular Formula | C16H35Cl2N3O2 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 7-amino-N-[3-(2,6-dimethylmorpholin-4-yl)propyl]heptanamide;dihydrochloride |
| SMILES | CC1CN(CCCNC(=O)CCCCCCN)CC(C)O1.Cl.Cl |
| InChI | InChI=1S/C16H33N3O2.2ClH/c1-14-12-19(13-15(2)21-14)11-7-10-18-16(20)8-5-3-4-6-9-17;;/h14-15H,3-13,17H2,1-2H3,(H,18,20);2*1H |
| InChIKey | KFEGORDMTDNOLY-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|