C17H37Cl2N3O — CID 119851231
7-amino-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]heptanamide;dihydrochloride (PubChem CID 119851231) has the molecular formula C17H37Cl2N3O and a molecular weight of 370.41 g/mol. Its IUPAC name is 7-amino-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119851231 |
| Molecular Formula | C17H37Cl2N3O |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 7-amino-N-[3-(3,5-dimethylpiperidin-1-yl)propyl]heptanamide;dihydrochloride |
| SMILES | CC1CC(C)CN(CCCNC(=O)CCCCCCN)C1.Cl.Cl |
| InChI | InChI=1S/C17H35N3O.2ClH/c1-15-12-16(2)14-20(13-15)11-7-10-19-17(21)8-5-3-4-6-9-18;;/h15-16H,3-14,18H2,1-2H3,(H,19,21);2*1H |
| InChIKey | QOXRLZJTGITOPQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|