C12H24N2O — CID 70842274
N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide (PubChem CID 70842274) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide.
| Compound Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide |
|---|---|
| PubChem CID | 70842274 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | N-[3-(3,5-dimethylpiperidin-1-yl)propyl]acetamide |
| SMILES | CC(=O)NCCCN1CC(C)CC(C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-10-7-11(2)9-14(8-10)6-4-5-13-12(3)15/h10-11H,4-9H2,1-3H3,(H,13,15) |
| InChIKey | LFTBIFRZBBRZKY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|