C15H29N5O3 — CID 94050726
2-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butylcarbamoylamino]propanediamide (PubChem CID 94050726) has the molecular formula C15H29N5O3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butylcarbamoylamino]propanediamide.
| Compound Name | 2-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butylcarbamoylamino]propanediamide |
|---|---|
| PubChem CID | 94050726 |
| Molecular Formula | C15H29N5O3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.23 |
| IUPAC Name | 2-[4-[(3S,5R)-3,5-dimethylpiperidin-1-yl]butylcarbamoylamino]propanediamide |
| SMILES | C[C@@H]1C[C@H](C)CN(CCCCNC(=O)NC(C(N)=O)C(N)=O)C1 |
| InChI | InChI=1S/C15H29N5O3/c1-10-7-11(2)9-20(8-10)6-4-3-5-18-15(23)19-12(13(16)21)14(17)22/h10-12H,3-9H2,1-2H3,(H2,16,21)(H2,17,22)(H2,18,19,23)/t10-,11+ |
| InChIKey | QXINEPNIGYZLPX-PHIMTYICSA-N |
| XLogP | -0.62 |
| TPSA | 130.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|