C19H32N4O3S — CID 55743624
1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[1-(3-sulfamoylphenyl)ethyl]urea (PubChem CID 55743624) has the molecular formula C19H32N4O3S and a molecular weight of 396.56 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[1-(3-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[1-(3-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55743624 |
| Molecular Formula | C19H32N4O3S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 1-[3-(3,5-dimethylpiperidin-1-yl)propyl]-3-[1-(3-sulfamoylphenyl)ethyl]urea |
| SMILES | CC1CC(C)CN(CCCNC(=O)NC(C)c2cccc(S(N)(=O)=O)c2)C1 |
| InChI | InChI=1S/C19H32N4O3S/c1-14-10-15(2)13-23(12-14)9-5-8-21-19(24)22-16(3)17-6-4-7-18(11-17)27(20,25)26/h4,6-7,11,14-16H,5,8-10,12-13H2,1-3H3,(H2,20,25,26)(H2,21,22,24) |
| InChIKey | JLYZZWANOXJJPI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|