C14H21N3O5S — CID 122000391
4-[1-[3-(methylsulfamoyl)phenyl]ethylcarbamoylamino]butanoic acid (PubChem CID 122000391) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is 4-[1-[3-(methylsulfamoyl)phenyl]ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[1-[3-(methylsulfamoyl)phenyl]ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122000391 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 4-[1-[3-(methylsulfamoyl)phenyl]ethylcarbamoylamino]butanoic acid |
| SMILES | CNS(=O)(=O)c1cccc(C(C)NC(=O)NCCCC(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O5S/c1-10(17-14(20)16-8-4-7-13(18)19)11-5-3-6-12(9-11)23(21,22)15-2/h3,5-6,9-10,15H,4,7-8H2,1-2H3,(H,18,19)(H2,16,17,20) |
| InChIKey | IBMNZXQSEPHVTI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|