C19H22F3N3O3S — CID 95701553
1-[(1S)-1-[3-(methylsulfamoyl)phenyl]ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea (PubChem CID 95701553) has the molecular formula C19H22F3N3O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is 1-[(1S)-1-[3-(methylsulfamoyl)phenyl]ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea.
| Compound Name | 1-[(1S)-1-[3-(methylsulfamoyl)phenyl]ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 95701553 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | 1-[(1S)-1-[3-(methylsulfamoyl)phenyl]ethyl]-3-[2-[4-(trifluoromethyl)phenyl]ethyl]urea |
| SMILES | CNS(=O)(=O)c1cccc([C@H](C)NC(=O)NCCc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C19H22F3N3O3S/c1-13(15-4-3-5-17(12-15)29(27,28)23-2)25-18(26)24-11-10-14-6-8-16(9-7-14)19(20,21)22/h3-9,12-13,23H,10-11H2,1-2H3,(H2,24,25,26)/t13-/m0/s1 |
| InChIKey | XEKPZZCESJQWQQ-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |