C16H20N4O3 — CID 122004350
4-[1-(3-imidazol-1-ylphenyl)ethylcarbamoylamino]butanoic acid (PubChem CID 122004350) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 4-[1-(3-imidazol-1-ylphenyl)ethylcarbamoylamino]butanoic acid.
| Compound Name | 4-[1-(3-imidazol-1-ylphenyl)ethylcarbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122004350 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 4-[1-(3-imidazol-1-ylphenyl)ethylcarbamoylamino]butanoic acid |
| SMILES | CC(NC(=O)NCCCC(=O)O)c1cccc(-n2ccnc2)c1 |
| InChI | InChI=1S/C16H20N4O3/c1-12(19-16(23)18-7-3-6-15(21)22)13-4-2-5-14(10-13)20-9-8-17-11-20/h2,4-5,8-12H,3,6-7H2,1H3,(H,21,22)(H2,18,19,23) |
| InChIKey | GDGRWCYFLMEYFU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|