C20H22N4O — CID 36870824
1-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-3-[(1R)-1-phenylethyl]urea (PubChem CID 36870824) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is 1-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-3-[(1R)-1-phenylethyl]urea.
| Compound Name | 1-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-3-[(1R)-1-phenylethyl]urea |
|---|---|
| PubChem CID | 36870824 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 1-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-3-[(1R)-1-phenylethyl]urea |
| SMILES | C[C@@H](NC(=O)N[C@H](C)c1ccc(-n2ccnc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4O/c1-15(17-6-4-3-5-7-17)22-20(25)23-16(2)18-8-10-19(11-9-18)24-13-12-21-14-24/h3-16H,1-2H3,(H2,22,23,25)/t15-,16-/m1/s1 |
| InChIKey | BIKHQVROWBVBSZ-HZPDHXFCSA-N |
| XLogP | 3.99 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |