C23H24N6O — CID 174999274
1,3-bis[1-(4-imidazol-1-ylphenyl)ethyl]urea (PubChem CID 174999274) has the molecular formula C23H24N6O and a molecular weight of 400.49 g/mol. Its IUPAC name is 1,3-bis[1-(4-imidazol-1-ylphenyl)ethyl]urea.
| Compound Name | 1,3-bis[1-(4-imidazol-1-ylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 174999274 |
| Molecular Formula | C23H24N6O |
| Molecular Weight | 400.49 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 1,3-bis[1-(4-imidazol-1-ylphenyl)ethyl]urea |
| SMILES | CC(NC(=O)NC(C)c1ccc(-n2ccnc2)cc1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C23H24N6O/c1-17(19-3-7-21(8-4-19)28-13-11-24-15-28)26-23(30)27-18(2)20-5-9-22(10-6-20)29-14-12-25-16-29/h3-18H,1-2H3,(H2,26,27,30) |
| InChIKey | RCOBFQRVQNGGKZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.49 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |