C19H24BrN3O3S — CID 52510601
1-[(2S)-4-(4-bromophenyl)butan-2-yl]-3-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea (PubChem CID 52510601) has the molecular formula C19H24BrN3O3S and a molecular weight of 454.39 g/mol. Its IUPAC name is 1-[(2S)-4-(4-bromophenyl)butan-2-yl]-3-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1-[(2S)-4-(4-bromophenyl)butan-2-yl]-3-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 52510601 |
| Molecular Formula | C19H24BrN3O3S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 1-[(2S)-4-(4-bromophenyl)butan-2-yl]-3-[(1R)-1-(3-sulfamoylphenyl)ethyl]urea |
| SMILES | C[C@@H](CCc1ccc(Br)cc1)NC(=O)N[C@H](C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C19H24BrN3O3S/c1-13(6-7-15-8-10-17(20)11-9-15)22-19(24)23-14(2)16-4-3-5-18(12-16)27(21,25)26/h3-5,8-14H,6-7H2,1-2H3,(H2,21,25,26)(H2,22,23,24)/t13-,14+/m0/s1 |
| InChIKey | JDECCCFEUPEGJV-UONOGXRCSA-N |
| XLogP | 3.48 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |