C13H21N3O3S — CID 112729478
1,1-diethyl-3-[1-(3-sulfamoylphenyl)ethyl]urea (PubChem CID 112729478) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 1,1-diethyl-3-[1-(3-sulfamoylphenyl)ethyl]urea.
| Compound Name | 1,1-diethyl-3-[1-(3-sulfamoylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 112729478 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1,1-diethyl-3-[1-(3-sulfamoylphenyl)ethyl]urea |
| SMILES | CCN(CC)C(=O)NC(C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C13H21N3O3S/c1-4-16(5-2)13(17)15-10(3)11-7-6-8-12(9-11)20(14,18)19/h6-10H,4-5H2,1-3H3,(H,15,17)(H2,14,18,19) |
| InChIKey | FBYMTLIXOPGLBK-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |