C12H19N3O3S — CID 43226387
N,N-dimethyl-2-[1-(3-sulfamoylphenyl)ethylamino]acetamide (PubChem CID 43226387) has the molecular formula C12H19N3O3S and a molecular weight of 285.37 g/mol. Its IUPAC name is N,N-dimethyl-2-[1-(3-sulfamoylphenyl)ethylamino]acetamide.
| Compound Name | N,N-dimethyl-2-[1-(3-sulfamoylphenyl)ethylamino]acetamide |
|---|---|
| PubChem CID | 43226387 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | N,N-dimethyl-2-[1-(3-sulfamoylphenyl)ethylamino]acetamide |
| SMILES | CC(NCC(=O)N(C)C)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H19N3O3S/c1-9(14-8-12(16)15(2)3)10-5-4-6-11(7-10)19(13,17)18/h4-7,9,14H,8H2,1-3H3,(H2,13,17,18) |
| InChIKey | TXHAQXNXFKCMSX-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |