C14H24N2O4S — CID 79537992
3-[1-(2,2-diethoxyethylamino)ethyl]benzenesulfonamide (PubChem CID 79537992) has the molecular formula C14H24N2O4S and a molecular weight of 316.42 g/mol. Its IUPAC name is 3-[1-(2,2-diethoxyethylamino)ethyl]benzenesulfonamide.
| Compound Name | 3-[1-(2,2-diethoxyethylamino)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 79537992 |
| Molecular Formula | C14H24N2O4S |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-[1-(2,2-diethoxyethylamino)ethyl]benzenesulfonamide |
| SMILES | CCOC(CNC(C)c1cccc(S(N)(=O)=O)c1)OCC |
| InChI | InChI=1S/C14H24N2O4S/c1-4-19-14(20-5-2)10-16-11(3)12-7-6-8-13(9-12)21(15,17)18/h6-9,11,14,16H,4-5,10H2,1-3H3,(H2,15,17,18) |
| InChIKey | GWFSWXXTGPGRQS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|