C14H19N3O2S2 — CID 104585100
3-[1-[2-(1,3-thiazol-2-yl)propylamino]ethyl]benzenesulfonamide (PubChem CID 104585100) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is 3-[1-[2-(1,3-thiazol-2-yl)propylamino]ethyl]benzenesulfonamide.
| Compound Name | 3-[1-[2-(1,3-thiazol-2-yl)propylamino]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104585100 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 3-[1-[2-(1,3-thiazol-2-yl)propylamino]ethyl]benzenesulfonamide |
| SMILES | CC(CNC(C)c1cccc(S(N)(=O)=O)c1)c1nccs1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-10(14-16-6-7-20-14)9-17-11(2)12-4-3-5-13(8-12)21(15,18)19/h3-8,10-11,17H,9H2,1-2H3,(H2,15,18,19) |
| InChIKey | UBUGUNPWDAFLJO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |