C15H14Cl2N2O3S — CID 51213469
3,5-dichloro-N-[1-(3-sulfamoylphenyl)ethyl]benzamide (PubChem CID 51213469) has the molecular formula C15H14Cl2N2O3S and a molecular weight of 373.26 g/mol. Its IUPAC name is 3,5-dichloro-N-[1-(3-sulfamoylphenyl)ethyl]benzamide.
| Compound Name | 3,5-dichloro-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 51213469 |
| Molecular Formula | C15H14Cl2N2O3S |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | 3,5-dichloro-N-[1-(3-sulfamoylphenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1cc(Cl)cc(Cl)c1)c1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C15H14Cl2N2O3S/c1-9(10-3-2-4-14(7-10)23(18,21)22)19-15(20)11-5-12(16)8-13(17)6-11/h2-9H,1H3,(H,19,20)(H2,18,21,22) |
| InChIKey | AXDBAQPWNXHAAO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |