C14H17N3O3S2 — CID 122159478
2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 122159478) has the molecular formula C14H17N3O3S2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 122159478 |
| Molecular Formula | C14H17N3O3S2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NC(C)c2cccc(S(N)(=O)=O)c2)c(C)s1 |
| InChI | InChI=1S/C14H17N3O3S2/c1-8(11-5-4-6-12(7-11)22(15,19)20)16-14(18)13-9(2)21-10(3)17-13/h4-8H,1-3H3,(H,16,18)(H2,15,19,20) |
| InChIKey | FHJLCEDTDQVBOP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |