C15H18N2O4S — CID 78814202
2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]furan-3-carboxamide (PubChem CID 78814202) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]furan-3-carboxamide.
| Compound Name | 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 78814202 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 2,5-dimethyl-N-[1-(3-sulfamoylphenyl)ethyl]furan-3-carboxamide |
| SMILES | Cc1cc(C(=O)NC(C)c2cccc(S(N)(=O)=O)c2)c(C)o1 |
| InChI | InChI=1S/C15H18N2O4S/c1-9-7-14(11(3)21-9)15(18)17-10(2)12-5-4-6-13(8-12)22(16,19)20/h4-8,10H,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | DBIWULXGIVEOQH-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |