C19H20N2O5S — CID 51213515
5-methoxy-3-methyl-N-[1-(3-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide (PubChem CID 51213515) has the molecular formula C19H20N2O5S and a molecular weight of 388.45 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-[1-(3-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-methoxy-3-methyl-N-[1-(3-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 51213515 |
| Molecular Formula | C19H20N2O5S |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 5-methoxy-3-methyl-N-[1-(3-sulfamoylphenyl)ethyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)NC(C)c3cccc(S(N)(=O)=O)c3)c(C)c2c1 |
| InChI | InChI=1S/C19H20N2O5S/c1-11-16-10-14(25-3)7-8-17(16)26-18(11)19(22)21-12(2)13-5-4-6-15(9-13)27(20,23)24/h4-10,12H,1-3H3,(H,21,22)(H2,20,23,24) |
| InChIKey | ALQGEEZIASKPNJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |