C21H23N3O4 — CID 55964822
5-methoxy-3-methyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 55964822) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 5-methoxy-3-methyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-methoxy-3-methyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55964822 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 5-methoxy-3-methyl-N-[2-(propan-2-ylcarbamoylamino)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3ccccc3NC(=O)NC(C)C)c(C)c2c1 |
| InChI | InChI=1S/C21H23N3O4/c1-12(2)22-21(26)24-17-8-6-5-7-16(17)23-20(25)19-13(3)15-11-14(27-4)9-10-18(15)28-19/h5-12H,1-4H3,(H,23,25)(H2,22,24,26) |
| InChIKey | UZVXIDZBPHZJIA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |