C18H15F2NO4 — CID 2667604
N-[2-(difluoromethoxy)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 2667604) has the molecular formula C18H15F2NO4 and a molecular weight of 347.32 g/mol. Its IUPAC name is N-[2-(difluoromethoxy)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-(difluoromethoxy)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2667604 |
| Molecular Formula | C18H15F2NO4 |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[2-(difluoromethoxy)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3ccccc3OC(F)F)c(C)c2c1 |
| InChI | InChI=1S/C18H15F2NO4/c1-10-12-9-11(23-2)7-8-14(12)24-16(10)17(22)21-13-5-3-4-6-15(13)25-18(19)20/h3-9,18H,1-2H3,(H,21,22) |
| InChIKey | UZSJYHFLNPMHSO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |