C18H17NO2 — CID 4570219
3-methyl-N-(1-phenylethyl)-1-benzofuran-2-carboxamide (PubChem CID 4570219) has the molecular formula C18H17NO2 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-methyl-N-(1-phenylethyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-(1-phenylethyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4570219 |
| Molecular Formula | C18H17NO2 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | 3-methyl-N-(1-phenylethyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)c2ccccc2)oc2ccccc12 |
| InChI | InChI=1S/C18H17NO2/c1-12-15-10-6-7-11-16(15)21-17(12)18(20)19-13(2)14-8-4-3-5-9-14/h3-11,13H,1-2H3,(H,19,20) |
| InChIKey | PKCRWVHTHCWGBR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |