C19H18N2O4 — CID 58417480
N-[(1R)-1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 58417480) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[(1R)-1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[(1R)-1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 58417480 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(1R)-1-[3-(hydroxycarbamoyl)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](C)c2cccc(C(=O)NO)c2)oc2ccccc12 |
| InChI | InChI=1S/C19H18N2O4/c1-11-15-8-3-4-9-16(15)25-17(11)19(23)20-12(2)13-6-5-7-14(10-13)18(22)21-24/h3-10,12,24H,1-2H3,(H,20,23)(H,21,22)/t12-/m1/s1 |
| InChIKey | NUKDPVAJTZFKHY-GFCCVEGCSA-N |
| XLogP | 3.35 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|