C19H17F2NO3 — CID 32592662
N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 32592662) has the molecular formula C19H17F2NO3 and a molecular weight of 345.34 g/mol. Its IUPAC name is N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 32592662 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | N-[(1R)-1-[2-(difluoromethoxy)phenyl]ethyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N[C@H](C)c2ccccc2OC(F)F)oc2ccccc12 |
| InChI | InChI=1S/C19H17F2NO3/c1-11-13-7-3-5-9-15(13)24-17(11)18(23)22-12(2)14-8-4-6-10-16(14)25-19(20)21/h3-10,12,19H,1-2H3,(H,22,23)/t12-/m1/s1 |
| InChIKey | WOKMTPXKCCHVQR-GFCCVEGCSA-N |
| XLogP | 4.83 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |