C13H13NO4 — CID 54990569
(2R)-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 54990569) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (2R)-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | (2R)-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 54990569 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (2R)-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1c(C(=O)N[C@H](C)C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C13H13NO4/c1-7-9-5-3-4-6-10(9)18-11(7)12(15)14-8(2)13(16)17/h3-6,8H,1-2H3,(H,14,15)(H,16,17)/t8-/m1/s1 |
| InChIKey | WHRPDGVLIWQSPC-MRVPVSSYSA-N |
| XLogP | 1.94 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |