C13H13NO5 — CID 43357642
3-hydroxy-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid (PubChem CID 43357642) has the molecular formula C13H13NO5 and a molecular weight of 263.25 g/mol. Its IUPAC name is 3-hydroxy-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-hydroxy-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 43357642 |
| Molecular Formula | C13H13NO5 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 3-hydroxy-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1c(C(=O)NC(CO)C(=O)O)oc2ccccc12 |
| InChI | InChI=1S/C13H13NO5/c1-7-8-4-2-3-5-10(8)19-11(7)12(16)14-9(6-15)13(17)18/h2-5,9,15H,6H2,1H3,(H,14,16)(H,17,18) |
| InChIKey | SJMCENCGOZZCOG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |