C17H19N3O5 — CID 171108175
N'-methyl-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide (PubChem CID 171108175) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is N'-methyl-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide.
| Compound Name | N'-methyl-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide |
|---|---|
| PubChem CID | 171108175 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | N'-methyl-2-[(3-methyl-1-benzofuran-2-carbonyl)amino]-5-oxohexanediamide |
| SMILES | CNC(=O)C(=O)CCC(NC(=O)c1oc2ccccc2c1C)C(N)=O |
| InChI | InChI=1S/C17H19N3O5/c1-9-10-5-3-4-6-13(10)25-14(9)17(24)20-11(15(18)22)7-8-12(21)16(23)19-2/h3-6,11H,7-8H2,1-2H3,(H2,18,22)(H,19,23)(H,20,24) |
| InChIKey | VLWPIEGVZSMNKR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 131.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|