C19H19NO2 — CID 40636003
3-methyl-N-[(1S)-1-phenylpropyl]-1-benzofuran-2-carboxamide (PubChem CID 40636003) has the molecular formula C19H19NO2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-1-phenylpropyl]-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-[(1S)-1-phenylpropyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 40636003 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 3-methyl-N-[(1S)-1-phenylpropyl]-1-benzofuran-2-carboxamide |
| SMILES | CC[C@H](NC(=O)c1oc2ccccc2c1C)c1ccccc1 |
| InChI | InChI=1S/C19H19NO2/c1-3-16(14-9-5-4-6-10-14)20-19(21)18-13(2)15-11-7-8-12-17(15)22-18/h4-12,16H,3H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | NGXXETASDIZPIR-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |