C14H14BrNO5 — CID 107822156
(2S)-2-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-hydroxybutanoic acid (PubChem CID 107822156) has the molecular formula C14H14BrNO5 and a molecular weight of 356.17 g/mol. Its IUPAC name is (2S)-2-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107822156 |
| Molecular Formula | C14H14BrNO5 |
| Molecular Weight | 356.17 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | (2S)-2-[(5-bromo-3-methyl-1-benzofuran-2-carbonyl)amino]-4-hydroxybutanoic acid |
| SMILES | Cc1c(C(=O)N[C@@H](CCO)C(=O)O)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C14H14BrNO5/c1-7-9-6-8(15)2-3-11(9)21-12(7)13(18)16-10(4-5-17)14(19)20/h2-3,6,10,17H,4-5H2,1H3,(H,16,18)(H,19,20)/t10-/m0/s1 |
| InChIKey | HWIRLNOPPONSDJ-JTQLQIEISA-N |
| XLogP | 2.07 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |