C14H14FNO5 — CID 81085318
2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methoxypropanoic acid (PubChem CID 81085318) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methoxypropanoic acid.
| Compound Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methoxypropanoic acid |
|---|---|
| PubChem CID | 81085318 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 2-[(5-fluoro-3-methyl-1-benzofuran-2-carbonyl)amino]-3-methoxypropanoic acid |
| SMILES | COCC(NC(=O)c1oc2ccc(F)cc2c1C)C(=O)O |
| InChI | InChI=1S/C14H14FNO5/c1-7-9-5-8(15)3-4-11(9)21-12(7)13(17)16-10(6-20-2)14(18)19/h3-5,10H,6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | DGCAYYQODLZPJC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |