C12H12FNO3 — CID 18169026
N-ethoxy-5-fluoro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 18169026) has the molecular formula C12H12FNO3 and a molecular weight of 237.23 g/mol. Its IUPAC name is N-ethoxy-5-fluoro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-ethoxy-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 18169026 |
| Molecular Formula | C12H12FNO3 |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | N-ethoxy-5-fluoro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCONC(=O)c1oc2ccc(F)cc2c1C |
| InChI | InChI=1S/C12H12FNO3/c1-3-16-14-12(15)11-7(2)9-6-8(13)4-5-10(9)17-11/h4-6H,3H2,1-2H3,(H,14,15) |
| InChIKey | SWZLMUVHLUPUAC-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|