C13H14ClNO4 — CID 79676953
5-chloro-N-(2-methoxyethoxy)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 79676953) has the molecular formula C13H14ClNO4 and a molecular weight of 283.71 g/mol. Its IUPAC name is 5-chloro-N-(2-methoxyethoxy)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(2-methoxyethoxy)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 79676953 |
| Molecular Formula | C13H14ClNO4 |
| Molecular Weight | 283.71 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 5-chloro-N-(2-methoxyethoxy)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COCCONC(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C13H14ClNO4/c1-8-10-7-9(14)3-4-11(10)19-12(8)13(16)15-18-6-5-17-2/h3-4,7H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | OUODOLSCKJCBKK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.71 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|