C14H15ClN2O3 — CID 17427942
5-chloro-N-[2-(ethylamino)-2-oxoethyl]-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 17427942) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 5-chloro-N-[2-(ethylamino)-2-oxoethyl]-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-[2-(ethylamino)-2-oxoethyl]-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17427942 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 5-chloro-N-[2-(ethylamino)-2-oxoethyl]-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | CCNC(=O)CNC(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C14H15ClN2O3/c1-3-16-12(18)7-17-14(19)13-8(2)10-6-9(15)4-5-11(10)20-13/h4-6H,3,7H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | FQMIFKHAHYGSLO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |