C14H14ClNO4S — CID 119241919
2-[2-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid (PubChem CID 119241919) has the molecular formula C14H14ClNO4S and a molecular weight of 327.79 g/mol. Its IUPAC name is 2-[2-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241919 |
| Molecular Formula | C14H14ClNO4S |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 2-[2-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]ethylsulfanyl]acetic acid |
| SMILES | Cc1c(C(=O)NCCSCC(=O)O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C14H14ClNO4S/c1-8-10-6-9(15)2-3-11(10)20-13(8)14(19)16-4-5-21-7-12(17)18/h2-3,6H,4-5,7H2,1H3,(H,16,19)(H,17,18) |
| InChIKey | NJOURIKYZDFGNW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|