C16H18ClNO4 — CID 119204062
4-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid (PubChem CID 119204062) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 4-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 119204062 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[(5-chloro-3-methyl-1-benzofuran-2-carbonyl)amino]-4-methylpentanoic acid |
| SMILES | Cc1c(C(=O)NC(C)(C)CCC(=O)O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H18ClNO4/c1-9-11-8-10(17)4-5-12(11)22-14(9)15(21)18-16(2,3)7-6-13(19)20/h4-5,8H,6-7H2,1-3H3,(H,18,21)(H,19,20) |
| InChIKey | FBVJYJFGOPWRJD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |