C15H18ClNO3 — CID 115884342
5-chloro-N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 115884342) has the molecular formula C15H18ClNO3 and a molecular weight of 295.77 g/mol. Its IUPAC name is 5-chloro-N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 115884342 |
| Molecular Formula | C15H18ClNO3 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-chloro-N-(3-hydroxy-2-methylbutan-2-yl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)NC(C)(C)C(C)O)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C15H18ClNO3/c1-8-11-7-10(16)5-6-12(11)20-13(8)14(19)17-15(3,4)9(2)18/h5-7,9,18H,1-4H3,(H,17,19) |
| InChIKey | WRQDWMYHYIMLAC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |