C16H11BrClNO2 — CID 27843870
N-(2-bromophenyl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 27843870) has the molecular formula C16H11BrClNO2 and a molecular weight of 364.63 g/mol. Its IUPAC name is N-(2-bromophenyl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-(2-bromophenyl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 27843870 |
| Molecular Formula | C16H11BrClNO2 |
| Molecular Weight | 364.63 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | N-(2-bromophenyl)-5-chloro-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2Br)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C16H11BrClNO2/c1-9-11-8-10(18)6-7-14(11)21-15(9)16(20)19-13-5-3-2-4-12(13)17/h2-8H,1H3,(H,19,20) |
| InChIKey | VFXUROLHYKJZAN-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |