C22H15BrClNO3 — CID 4543107
5-bromo-N-(5-chloro-2-phenoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 4543107) has the molecular formula C22H15BrClNO3 and a molecular weight of 456.72 g/mol. Its IUPAC name is 5-bromo-N-(5-chloro-2-phenoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(5-chloro-2-phenoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 4543107 |
| Molecular Formula | C22H15BrClNO3 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 454.99 |
| IUPAC Name | 5-bromo-N-(5-chloro-2-phenoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Oc2ccccc2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C22H15BrClNO3/c1-13-17-11-14(23)7-9-19(17)28-21(13)22(26)25-18-12-15(24)8-10-20(18)27-16-5-3-2-4-6-16/h2-12H,1H3,(H,25,26) |
| InChIKey | OTLYXBOPIHACFO-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |