C17H11BrF3NO2 — CID 35181529
5-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 35181529) has the molecular formula C17H11BrF3NO2 and a molecular weight of 398.18 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 35181529 |
| Molecular Formula | C17H11BrF3NO2 |
| Molecular Weight | 398.18 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | 5-bromo-3-methyl-N-[2-(trifluoromethyl)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccccc2C(F)(F)F)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C17H11BrF3NO2/c1-9-11-8-10(18)6-7-14(11)24-15(9)16(23)22-13-5-3-2-4-12(13)17(19,20)21/h2-8H,1H3,(H,22,23) |
| InChIKey | XFBOACWJBLHUTJ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.18 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |