C19H13BrN2O2 — CID 9405214
5-bromo-3-methyl-N-quinolin-8-yl-1-benzofuran-2-carboxamide (PubChem CID 9405214) has the molecular formula C19H13BrN2O2 and a molecular weight of 381.23 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-quinolin-8-yl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-quinolin-8-yl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 9405214 |
| Molecular Formula | C19H13BrN2O2 |
| Molecular Weight | 381.23 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-bromo-3-methyl-N-quinolin-8-yl-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc3cccnc23)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C19H13BrN2O2/c1-11-14-10-13(20)7-8-16(14)24-18(11)19(23)22-15-6-2-4-12-5-3-9-21-17(12)15/h2-10H,1H3,(H,22,23) |
| InChIKey | DMWLNESUSLCJRU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.23 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |