C18H12BrNO2 — CID 36663983
5-bromo-N-(3-ethynylphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 36663983) has the molecular formula C18H12BrNO2 and a molecular weight of 354.20 g/mol. Its IUPAC name is 5-bromo-N-(3-ethynylphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-N-(3-ethynylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 36663983 |
| Molecular Formula | C18H12BrNO2 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 5-bromo-N-(3-ethynylphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | C#Cc1cccc(NC(=O)c2oc3ccc(Br)cc3c2C)c1 |
| InChI | InChI=1S/C18H12BrNO2/c1-3-12-5-4-6-14(9-12)20-18(21)17-11(2)15-10-13(19)7-8-16(15)22-17/h1,4-10H,2H3,(H,20,21) |
| InChIKey | DNRHZVVDBSVNSR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|