C17H11BrF3NO3 — CID 2469337
5-bromo-3-methyl-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide (PubChem CID 2469337) has the molecular formula C17H11BrF3NO3 and a molecular weight of 414.18 g/mol. Its IUPAC name is 5-bromo-3-methyl-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-bromo-3-methyl-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 2469337 |
| Molecular Formula | C17H11BrF3NO3 |
| Molecular Weight | 414.18 g/mol |
| Exact Mass | 412.99 |
| IUPAC Name | 5-bromo-3-methyl-N-[4-(trifluoromethoxy)phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(OC(F)(F)F)cc2)oc2ccc(Br)cc12 |
| InChI | InChI=1S/C17H11BrF3NO3/c1-9-13-8-10(18)2-7-14(13)24-15(9)16(23)22-11-3-5-12(6-4-11)25-17(19,20)21/h2-8H,1H3,(H,22,23) |
| InChIKey | KAOQGAPFWQQVEV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.18 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |