C18H13ClF3NO3 — CID 7930823
N-[4-chloro-3-(trifluoromethyl)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 7930823) has the molecular formula C18H13ClF3NO3 and a molecular weight of 383.75 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7930823 |
| Molecular Formula | C18H13ClF3NO3 |
| Molecular Weight | 383.75 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-methoxy-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc2oc(C(=O)Nc3ccc(Cl)c(C(F)(F)F)c3)c(C)c2c1 |
| InChI | InChI=1S/C18H13ClF3NO3/c1-9-12-8-11(25-2)4-6-15(12)26-16(9)17(24)23-10-3-5-14(19)13(7-10)18(20,21)22/h3-8H,1-2H3,(H,23,24) |
| InChIKey | OKOQLXNAGWNXEO-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.75 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |