C17H14ClNO3 — CID 7992434
5-chloro-N-(3-methoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide (PubChem CID 7992434) has the molecular formula C17H14ClNO3 and a molecular weight of 315.76 g/mol. Its IUPAC name is 5-chloro-N-(3-methoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-(3-methoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7992434 |
| Molecular Formula | C17H14ClNO3 |
| Molecular Weight | 315.76 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 5-chloro-N-(3-methoxyphenyl)-3-methyl-1-benzofuran-2-carboxamide |
| SMILES | COc1cccc(NC(=O)c2oc3ccc(Cl)cc3c2C)c1 |
| InChI | InChI=1S/C17H14ClNO3/c1-10-14-8-11(18)6-7-15(14)22-16(10)17(20)19-12-4-3-5-13(9-12)21-2/h3-9H,1-2H3,(H,19,20) |
| InChIKey | SDZWISNVCPAKAV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.76 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |