C20H19ClN2O3 — CID 55951792
5-chloro-3-methyl-N-(3-morpholin-4-ylphenyl)-1-benzofuran-2-carboxamide (PubChem CID 55951792) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 5-chloro-3-methyl-N-(3-morpholin-4-ylphenyl)-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-3-methyl-N-(3-morpholin-4-ylphenyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55951792 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 5-chloro-3-methyl-N-(3-morpholin-4-ylphenyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cccc(N3CCOCC3)c2)oc2ccc(Cl)cc12 |
| InChI | InChI=1S/C20H19ClN2O3/c1-13-17-11-14(21)5-6-18(17)26-19(13)20(24)22-15-3-2-4-16(12-15)23-7-9-25-10-8-23/h2-6,11-12H,7-10H2,1H3,(H,22,24) |
| InChIKey | NOABQOXIZQLOKU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |