C24H26ClN3O4 — CID 55380606
5-chloro-N-ethyl-3-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide (PubChem CID 55380606) has the molecular formula C24H26ClN3O4 and a molecular weight of 455.94 g/mol. Its IUPAC name is 5-chloro-N-ethyl-3-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide.
| Compound Name | 5-chloro-N-ethyl-3-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 55380606 |
| Molecular Formula | C24H26ClN3O4 |
| Molecular Weight | 455.94 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 5-chloro-N-ethyl-3-methyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]-1-benzofuran-2-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)c1oc2ccc(Cl)cc2c1C |
| InChI | InChI=1S/C24H26ClN3O4/c1-3-27(24(30)23-16(2)20-14-17(25)4-9-21(20)32-23)15-22(29)26-18-5-7-19(8-6-18)28-10-12-31-13-11-28/h4-9,14H,3,10-13,15H2,1-2H3,(H,26,29) |
| InChIKey | NUVBFQYZKUHDTI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.94 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|