C24H25ClN4O3 — CID 55666693
1-chloro-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]isoquinoline-3-carboxamide (PubChem CID 55666693) has the molecular formula C24H25ClN4O3 and a molecular weight of 452.94 g/mol. Its IUPAC name is 1-chloro-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]isoquinoline-3-carboxamide.
| Compound Name | 1-chloro-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 55666693 |
| Molecular Formula | C24H25ClN4O3 |
| Molecular Weight | 452.94 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | 1-chloro-N-ethyl-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]isoquinoline-3-carboxamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)c1cc2ccccc2c(Cl)n1 |
| InChI | InChI=1S/C24H25ClN4O3/c1-2-28(24(31)21-15-17-5-3-4-6-20(17)23(25)27-21)16-22(30)26-18-7-9-19(10-8-18)29-11-13-32-14-12-29/h3-10,15H,2,11-14,16H2,1H3,(H,26,30) |
| InChIKey | BDDIAXWOMAFTLN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.94 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|