C21H23BrFN3O3 — CID 55388550
2-bromo-N-ethyl-4-fluoro-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide (PubChem CID 55388550) has the molecular formula C21H23BrFN3O3 and a molecular weight of 464.34 g/mol. Its IUPAC name is 2-bromo-N-ethyl-4-fluoro-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide.
| Compound Name | 2-bromo-N-ethyl-4-fluoro-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55388550 |
| Molecular Formula | C21H23BrFN3O3 |
| Molecular Weight | 464.34 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | 2-bromo-N-ethyl-4-fluoro-N-[2-(4-morpholin-4-ylanilino)-2-oxoethyl]benzamide |
| SMILES | CCN(CC(=O)Nc1ccc(N2CCOCC2)cc1)C(=O)c1ccc(F)cc1Br |
| InChI | InChI=1S/C21H23BrFN3O3/c1-2-25(21(28)18-8-3-15(23)13-19(18)22)14-20(27)24-16-4-6-17(7-5-16)26-9-11-29-12-10-26/h3-8,13H,2,9-12,14H2,1H3,(H,24,27) |
| InChIKey | BWCFOQHQUSIVIN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|